Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1S,2R)-2-Methoxy-1-indanamine |
|---|---|
| Synonyms | (1S,2R)-2-methoxy-2,3-dihydro-1H-inden-1-amine |
| Molecular Structure |  |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 |
| CAS Registry Number | 765914-19-0 |
| SMILES | CO[C@@H]1Cc2ccccc2[C@@H]1N |
| InChI | 1S/C10H13NO/c1-12-9-6-7-4-2-3-5-8(7)10(9)11/h2-5,9-10H,6,11H2,1H3/t9-,10+/m1/s1 |
| InChIKey | IGDBSYLULISNJI-ZJUUUORDSA-N |
| Density | 1.103g/cm3 (Cal.) |
|---|---|
| Boiling point | 256.058°C at 760 mmHg (Cal.) |
| Flash point | 110.614°C (Cal.) |
| Refractive index | 1.57 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S,2R)-2-Methoxy-1-indanamine |