Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | cis,trans,trans-1,2,4-Trimethylcyclohexane |
|---|---|
| Synonyms | Cyclohexane, 1,2,4-Trimethyl-, Trans,Cis-; Nsc73967; Trans, Cis-1,2,4-Trimethylcyclohexane |
| Molecular Structure |  |
| Molecular Formula | C9H18 |
| Molecular Weight | 126.24 |
| CAS Registry Number | 7667-60-9 |
| SMILES | [C@@H]1(CC[C@H](C)[C@H](C1)C)C |
| InChI | 1S/C9H18/c1-7-4-5-8(2)9(3)6-7/h7-9H,4-6H2,1-3H3/t7-,8-,9-/m0/s1 |
| InChIKey | VCJPCEVERINRSG-CIUDSAMLSA-N |
| Density | 0.759g/cm3 (Cal.) |
|---|---|
| Boiling point | 143.462°C at 760 mmHg (Cal.) |
| Flash point | 27.902°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for cis,trans,trans-1,2,4-Trimethylcyclohexane |