Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl (1R,2S,5S)-2-amino-5-methylcyclopentanecarboxylate |
|---|---|
| Synonyms | (1R,2S,5S)-methyl 2-amino-5-methylcyclopentanecarboxylate |
| Molecular Structure |  |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 |
| CAS Registry Number | 767260-87-7 |
| SMILES | C[C@H]1CC[C@@H]([C@@H]1C(=O)OC)N |
| InChI | 1S/C8H15NO2/c1-5-3-4-6(9)7(5)8(10)11-2/h5-7H,3-4,9H2,1-2H3/t5-,6-,7+/m0/s1 |
| InChIKey | BXFHFLNPTDKXAM-LYFYHCNISA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 205.2±33.0°C at 760 mmHg (Cal.) |
| Flash point | 75.3±22.9°C (Cal.) |
| Refractive index | 1.462 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (1R,2S,5S)-2-amino-5-methylcyclopentanecarboxylate |