Online Database of Chemicals from Around the World
|
CAS#: 767293-92-5 Product: Methyl 4-[3-(hydroxymethyl)-2,5-dimethyl-1H-pyrrol-1-yl]-3-methylbenzoate No suppilers available for the product. |
| Name | Methyl 4-[3-(hydroxymethyl)-2,5-dimethyl-1H-pyrrol-1-yl]-3-methylbenzoate |
|---|---|
| Molecular Structure | ![CAS#: 767293-92-5， Methyl 4-[3-(hydroxymethyl)-2,5-dimethyl-1H-pyrrol-1-yl]-3-methylbenzoate](/moreStructures/767293-92-5.gif) |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 |
| CAS Registry Number | 767293-92-5 |
| SMILES | Cc1cc(ccc1n2c(cc(c2C)CO)C)C(=O)OC |
| InChI | 1S/C16H19NO3/c1-10-7-13(16(19)20-4)5-6-15(10)17-11(2)8-14(9-18)12(17)3/h5-8,18H,9H2,1-4H3 |
| InChIKey | HPYNMEXSAFAHLG-UHFFFAOYSA-N |
| Density | 1.132g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.027°C at 760 mmHg (Cal.) |
| Flash point | 223.55°C (Cal.) |
| Refractive index | 1.555 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4-[3-(hydroxymethyl)-2,5-dimethyl-1H-pyrrol-1-yl]-3-methylbenzoate |