| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Isoleucine derivative |
|---|---|
| Name | N-Cyclohexylcyclohexanaminium (2S,3S)-3-methyl-2-{[(2-nitrophenyl)sulfanyl]amino}pentanoate |
| Synonyms | N-2-Nitro |
| Molecular Structure | ![]() |
| Molecular Formula | C24H39N3O4S |
| Molecular Weight | 465.65 |
| CAS Registry Number | 7675-49-2 |
| SMILES | CC[C@H](C)[C@@H](C(=O)[O-])NSc1ccccc1[N+](=O)[O-].C1CCC(CC1)[NH2+]C2CCCCC2 |
| InChI | 1S/C12H16N2O4S.C12H23N/c1-3-8(2)11(12(15)16)13-19-10-7-5-4-6-9(10)14(17)18;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h4-8,11,13H,3H2,1-2H3,(H,15,16);11-13H,1-10H2/t8-,11-;/m0./s1 |
| InChIKey | IBYYSIWLIRUKII-RWHJDYSMSA-N |
| Melting point | 190°C (Expl.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-Cyclohexylcyclohexanaminium (2S,3S)-3-methyl-2-{[(2-nitrophenyl)sulfanyl]amino}pentanoate |