Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | Phenyl 3-Amino-4-Methylbenzoate |
|---|---|
| Synonyms | Phenyl 3-Amino-4-Methyl-Benzoate; 3-Amino-4-Methylbenzoic Acid Phenyl Ester; 3-Amino-4-Methyl-Benzoic Acid Phenyl Ester |
| Molecular Structure |  |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 |
| CAS Registry Number | 76765-60-1 |
| EINECS | 278-546-6 |
| SMILES | C2=C(C(OC1=CC=CC=C1)=O)C=CC(=C2N)C |
| InChI | 1S/C14H13NO2/c1-10-7-8-11(9-13(10)15)14(16)17-12-5-3-2-4-6-12/h2-9H,15H2,1H3 |
| InChIKey | FLDBLKUKZWISKY-UHFFFAOYSA-N |
| Density | 1.187g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.888°C at 760 mmHg (Cal.) |
| Flash point | 248.091°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl 3-Amino-4-Methylbenzoate |