Online Database of Chemicals from Around the World
|
CAS#: 76788-93-7 Product: Benzhydrazone No suppilers available for the product. |
| Name | Benzhydrazone |
|---|---|
| Synonyms | 2-[[(3Z)-3-(Diaminomethylenehydrazono)Cyclopenta[B]Naphthalen-1-Ylidene]Amino]Guanidine; 2-[[(3Z)-3-(Diaminomethylenehydrazono)-1-Cyclopenta[B]Naphthalenylidene]Amino]Guanidine; 1H-Benz(F)Indene-1,3(2H)Dione-Bis-Amidinohydrazone |
| Molecular Structure |  |
| Molecular Formula | C15H16N8 |
| Molecular Weight | 308.35 |
| CAS Registry Number | 76788-93-7 |
| SMILES | C1=C3C(=CC2=CC=CC=C12)C(=N/N=C(N)N)\C/C3=N/N=C(N)N |
| InChI | 1S/C15H16N8/c16-14(17)22-20-12-7-13(21-23-15(18)19)11-6-9-4-2-1-3-8(9)5-10(11)12/h1-6H,7H2,(H4,16,17,22)(H4,18,19,23)/b20-12-,21-13- |
| InChIKey | UJQDRPLHEPIIAC-FDYZEBBJSA-N |
| Density | 1.585g/cm3 (Cal.) |
|---|---|
| Boiling point | 637.536°C at 760 mmHg (Cal.) |
| Flash point | 339.37°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzhydrazone |