Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1-fluoro-4-(4-heptylcyclohexyl)benzene |
|---|---|
| Synonyms | trans-1-Fluoro-4-(4-heptyl-cyclohexyl)-benzene; TRANS-4'-HEPTYLCYCLOHEXYL-4-FLUOROBENZENE; TRANS-4-HEPTYLCYCLOHEXYL-4-FLUOROBENZENE |
| Molecular Structure |  |
| Molecular Formula | C19H29F |
| Molecular Weight | 276.43 |
| CAS Registry Number | 76802-59-0 |
| SMILES | Fc1ccc(cc1)[C@@H]2CC[C@@H](CCCCCCC)CC2 |
| InChI | 1S/C19H29F/c1-2-3-4-5-6-7-16-8-10-17(11-9-16)18-12-14-19(20)15-13-18/h12-17H,2-11H2,1H3/t16-,17- |
| InChIKey | ZPNZXIUICNXXNC-QAQDUYKDSA-N |
| Density | 0.937g/cm3 (Cal.) |
|---|---|
| Boiling point | 355.032°C at 760 mmHg (Cal.) |
| Flash point | 158.683°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-fluoro-4-(4-heptylcyclohexyl)benzene |