| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1-(2-Chlorophenyl)Piperazine Dihydrochloride |
|---|---|
| Synonyms | Nsc71660; 1-(O-Chlorophenyl)Piperazine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14Cl2N2 |
| Molecular Weight | 233.14 |
| CAS Registry Number | 76835-05-7 |
| EINECS | 259-929-7 |
| SMILES | [H+].C2=C(N1CCNCC1)C(=CC=C2)Cl.[Cl-] |
| InChI | 1S/C10H13ClN2.ClH/c11-9-3-1-2-4-10(9)13-7-5-12-6-8-13;/h1-4,12H,5-8H2;1H |
| InChIKey | GUTWDZXWTKMXPI-UHFFFAOYSA-N |
| Melting point | 167-169°C (Expl.) |
|---|---|
| Safety Code | S26;S36/37 Details |
|---|---|
| Risk Code | R22;R36/37/38 Details |
| Hazard Symbol | X Details |
| Safety Description | WARNING: Irritates lungs, eyes, skin |
| WARNING: Irritates skin and eyes, harmful if swallowed | |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Chlorophenyl)Piperazine Dihydrochloride |