|
CAS#: 7685-67-8 Product: N-[(2-Nitrophenyl)sulfanyl]-L-leucine No suppilers available for the product. |
| Classification | Biochemical >> Amino acids and their derivatives >> Leucine derivative |
|---|---|
| Name | N-[(2-Nitrophenyl)sulfanyl]-L-leucine |
| Synonyms | N-2-Nitrophenylsulfenyl-L-leucine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.33 |
| CAS Registry Number | 7685-67-8 |
| SMILES | [O-][N+](=O)c1ccccc1SN[C@H](C(=O)O)CC(C)C |
| InChI | 1S/C12H16N2O4S/c1-8(2)7-9(12(15)16)13-19-11-6-4-3-5-10(11)14(17)18/h3-6,8-9,13H,7H2,1-2H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | OITRGNOZDXVYFU-VIFPVBQESA-N |
| Density | 1.305g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.255°C at 760 mmHg (Cal.) |
| Flash point | 226.107°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(2-Nitrophenyl)sulfanyl]-L-leucine |