Online Database of Chemicals from Around the World
|
CAS#: 76907-77-2 Product: 1,7-Dihydroxy-3,4-Dimethoxyxanthen-9-One No suppilers available for the product. |
| Name | 1,7-Dihydroxy-3,4-Dimethoxyxanthen-9-One |
|---|---|
| Synonyms | 1,7-Dihydroxy-3,4-Dimethoxy-Xanthen-9-One; 1,7-Dihydroxy-3,4-Dimethoxy-9-Xanthenone; 1,7-Dihydroxy-3,4-Dimethoxy-Xanthone |
| Molecular Structure |  |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.26 |
| CAS Registry Number | 76907-77-2 |
| SMILES | C1=C(OC)C(=C3C(=C1O)C(C2=C(C=CC(=C2)O)O3)=O)OC |
| InChI | 1S/C15H12O6/c1-19-11-6-9(17)12-13(18)8-5-7(16)3-4-10(8)21-15(12)14(11)20-2/h3-6,16-17H,1-2H3 |
| InChIKey | NQNPLVZPJSLIIA-UHFFFAOYSA-N |
| Density | 1.452g/cm3 (Cal.) |
|---|---|
| Boiling point | 546.35°C at 760 mmHg (Cal.) |
| Flash point | 210.656°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,7-Dihydroxy-3,4-Dimethoxyxanthen-9-One |