Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-n-Propylbicyclo[2.2.2]Octan-1-Ol |
|---|---|
| Synonyms | 4-N-PROPYLBICYCLO[2.2.2]OCTAN-1-OL |
| Molecular Structure | ![CAS#: 76921-54-5， 4-n-Propylbicyclo[2.2.2]Octan-1-Ol](/moreStructures/76921-54-5.gif) |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 |
| CAS Registry Number | 76921-54-5 |
| SMILES | CCC[C@]12CC[C@](CC1)(CC2)O |
| InChI | 1S/C11H20O/c1-2-3-10-4-7-11(12,8-5-10)9-6-10/h12H,2-9H2,1H3/t10-,11- |
| Market Analysis Reports |
| List of Reports Available for 4-n-Propylbicyclo[2.2.2]Octan-1-Ol |