Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-Ethoxy-1H-pyrimido[4,5-b]indole |
|---|---|
| Synonyms | 1H-Pyrimido[4,5-b]indole,4-ethoxy-; 4-ethoxy-1H-pyrimido[4,5-b]indole |
| Molecular Structure | ![CAS#: 76945-06-7， 4-Ethoxy-1H-pyrimido[4,5-b]indole](/moreStructures/76945-06-7.gif) |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 |
| CAS Registry Number | 76945-06-7 |
| SMILES | CCOc1c2c3ccccc3[nH]c2ncn1 |
| InChI | 1S/C12H11N3O/c1-2-16-12-10-8-5-3-4-6-9(8)15-11(10)13-7-14-12/h3-7H,2H2,1H3,(H,13,14,15) |
| InChIKey | FZQPAIZCWNHPJU-UHFFFAOYSA-N |
| Density | 1.309g/cm3 (Cal.) |
|---|---|
| Boiling point | 422.9°C at 760 mmHg (Cal.) |
| Flash point | 152.656°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Ethoxy-1H-pyrimido[4,5-b]indole |