Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Ethyl 2-(2,6-dichlorophenyl)-2-hydroxyethanimidate |
|---|---|
| Synonyms | ethyl 2-(2,6-dichlorophenyl)-2-hydroxyacetimidate |
| Molecular Structure |  |
| Molecular Formula | C10H11Cl2NO2 |
| Molecular Weight | 248.11 |
| CAS Registry Number | 769857-90-1 |
| SMILES | CCOC(=N)C(c1c(cccc1Cl)Cl)O |
| InChI | 1S/C10H11Cl2NO2/c1-2-15-10(13)9(14)8-6(11)4-3-5-7(8)12/h3-5,9,13-14H,2H2,1H3 |
| InChIKey | LMSMJBQHVGYJFK-UHFFFAOYSA-N |
| Density | 1.353g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.395°C at 760 mmHg (Cal.) |
| Flash point | 150.594°C (Cal.) |
| Refractive index | 1.559 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-(2,6-dichlorophenyl)-2-hydroxyethanimidate |