Online Database of Chemicals from Around the World
|
CAS#: 7699-30-1 Product: Desmethyl-Methylparathion No suppilers available for the product. |
| Name | Desmethyl-Methylparathion |
|---|---|
| Synonyms | Hydroxy-Methoxy-(4-Nitrophenoxy)-Thioxo-Phosphorane; Hydroxy-Methoxy-(4-Nitrophenoxy)-Thioxophosphorane; Hydroxy-Methoxy-(4-Nitrophenoxy)-Sulfanylidene-Phosphorane |
| Molecular Structure |  |
| Molecular Formula | C7H8NO5PS |
| Molecular Weight | 249.18 |
| CAS Registry Number | 7699-30-1 |
| SMILES | C1=CC(=CC=C1O[P](OC)(O)=S)[N+](=O)[O-] |
| InChI | 1S/C7H8NO5PS/c1-12-14(11,15)13-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H,11,15) |
| InChIKey | UEMHPBBZLQPEBN-UHFFFAOYSA-N |
| Density | 1.546g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.501°C at 760 mmHg (Cal.) |
| Flash point | 185.735°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Desmethyl-Methylparathion |