|
CAS#: 77-15-6 Product: Ethoheptazine No suppilers available for the product. |
| Name | Ethoheptazine |
|---|---|
| Synonyms | Citric Acid; Ethyl 1-Methyl-4-Phenyl-Azepane-4-Carboxylate; Citric Acid; 1-Methyl-4-Phenyl-4-Azepanecarboxylic Acid Ethyl Ester; Citric Acid; 1-Methyl-4-Phenyl-Azepane-4-Carboxylic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C22H31NO9 |
| Molecular Weight | 453.49 |
| CAS Registry Number | 77-15-6 (2085-42-9) |
| EINECS | 201-007-3 |
| SMILES | C2=C(C1(C(OCC)=O)CCN(CCC1)C)C=CC=C2.C(C(O)(C(=O)O)CC(=O)O)C(=O)O |
| InChI | 1S/C16H23NO2.C6H8O7/c1-3-19-15(18)16(14-8-5-4-6-9-14)10-7-12-17(2)13-11-16;7-3(8)1-6(13,5(11)12)2-4(9)10/h4-6,8-9H,3,7,10-13H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | KCVHFFSPDODYOG-UHFFFAOYSA-N |
| Boiling point | 346.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 114.4°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Ethoheptazine |