Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | (+/-)-trans-1,2-Dihydroxy-1,2-Dihydronaphthalene |
|---|---|
| Synonyms | 1,2-Naphthalenediol, 1,2-Dihydro-, (1R,2R)-Rel-; 1,2-Naphthalenediol, 1,2-Dihydro-, Trans-; Trans-1,2-Dihydro-1,2-Naphthalenediol |
| Molecular Structure |  |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 |
| CAS Registry Number | 771-16-4 |
| SMILES | [C@@H]2(C1=CC=CC=C1C=C[C@@H]2O)O |
| InChI | 1S/C10H10O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6,9-12H/t9-,10-/m0/s1 |
| InChIKey | QPUHWUSUBHNZCG-UWVGGRQHSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 331.422°C at 760 mmHg (Cal.) |
| Flash point | 166.671°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (+/-)-trans-1,2-Dihydroxy-1,2-Dihydronaphthalene |