Online Database of Chemicals from Around the World
|
CAS#: 77282-37-2 Product: 3-Bromo-2-Methoxyacridine-1,4-Dione No suppilers available for the product. |
| Name | 3-Bromo-2-Methoxyacridine-1,4-Dione |
|---|---|
| Synonyms | 3-Bromo-2-Methoxy-Acridine-1,4-Dione; 3-Bromo-2-Methoxy-Acridine-1,4-Quinone; 1,4-Acridinedione, 3-Bromo-2-Methoxy- |
| Molecular Structure |  |
| Molecular Formula | C14H8BrNO3 |
| Molecular Weight | 318.13 |
| CAS Registry Number | 77282-37-2 |
| SMILES | C1=C3C(=NC2=C1C(=O)C(=C(Br)C2=O)OC)C=CC=C3 |
| InChI | 1S/C14H8BrNO3/c1-19-14-10(15)13(18)11-8(12(14)17)6-7-4-2-3-5-9(7)16-11/h2-6H,1H3 |
| InChIKey | VBSQGPMTEQVKDH-UHFFFAOYSA-N |
| Density | 1.707g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.168°C at 760 mmHg (Cal.) |
| Flash point | 236.335°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Bromo-2-Methoxyacridine-1,4-Dione |