Online Database of Chemicals from Around the World
| Rare Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
 |
+49 (431) 5606-600 | |||
 |
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Trylead Chemical Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 (571) 8708-6220 | |||
|
info@trylead-chem.com | |||
| Chemical manufacturer since 2006 | ||||
| Name | ethyl 3-chloro-4-(trifluoromethoxy)benzoate |
|---|---|
| Synonyms | Benzoic acid, 3-chloro-4-(trifluoromethoxy)-, ethyl ester |
| Molecular Structure |  |
| Molecular Formula | C10H8ClF3O3 |
| Molecular Weight | 268.62 |
| CAS Registry Number | 773135-54-9 |
| SMILES | CCOC(=O)c1ccc(c(c1)Cl)OC(F)(F)F |
| InChI | 1S/C10H8ClF3O3/c1-2-16-9(15)6-3-4-8(7(11)5-6)17-10(12,13)14/h3-5H,2H2,1H3 |
| InChIKey | SBVMMTNIRDZESF-UHFFFAOYSA-N |
| Density | 1.369g/cm3 (Cal.) |
|---|---|
| Boiling point | 268.848°C at 760 mmHg (Cal.) |
| Flash point | 99.98°C (Cal.) |
| Refractive index | 1.469 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for ethyl 3-chloro-4-(trifluoromethoxy)benzoate |