Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Ethyl 2-methyl-4-quinolinecarboximidate |
|---|---|
| Synonyms | ethyl 2-methylquinoline-4-carbimidate |
| Molecular Structure |  |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.26 |
| CAS Registry Number | 773792-87-3 |
| SMILES | CCOC(=N)c1cc(nc2c1cccc2)C |
| InChI | 1S/C13H14N2O/c1-3-16-13(14)11-8-9(2)15-12-7-5-4-6-10(11)12/h4-8,14H,3H2,1-2H3 |
| InChIKey | LCQUOMURDLVOLR-UHFFFAOYSA-N |
| Density | 1.121g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.193°C at 760 mmHg (Cal.) |
| Flash point | 151.077°C (Cal.) |
| Refractive index | 1.577 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-methyl-4-quinolinecarboximidate |