Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | (5Z)-3,4-Dimethyl-5-Pentylidene-2(5H)-Furanone |
|---|---|
| Synonyms | (5E)-3,4-Dimethyl-5-Pentylidene-Furan-2-One; (5E)-3,4-Dimethyl-5-Pentylidene-2-Furanone; Brn 1343514 |
| Molecular Structure |  |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 |
| CAS Registry Number | 774-64-1 |
| SMILES | C(\C=C/1OC(=O)C(=C1C)C)CCC |
| InChI | 1S/C11H16O2/c1-4-5-6-7-10-8(2)9(3)11(12)13-10/h7H,4-6H2,1-3H3/b10-7+ |
| InChIKey | MTQPZHNZYWAXEH-JXMROGBWSA-N |
| Density | 1.046g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.687°C at 760 mmHg (Cal.) |
| Flash point | 118.104°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (5Z)-3,4-Dimethyl-5-Pentylidene-2(5H)-Furanone |