Online Database of Chemicals from Around the World
|
CAS#: 77442-84-3 Product: 6,6'-(1,10-Decanediyl)bis(1,3,5-triazine-2,4-diamine) No suppilers available for the product. |
| Name | 6,6'-(1,10-Decanediyl)bis(1,3,5-triazine-2,4-diamine) |
|---|---|
| Synonyms | 6,6'-(decane-1,10-diyl)bis(1,3,5-triazine-2,4-diamine) |
| Molecular Structure |  |
| Molecular Formula | C16H28N10 |
| Molecular Weight | 360.46 |
| CAS Registry Number | 77442-84-3 |
| EINECS | 278-689-4 |
| SMILES | Nc2nc(CCCCCCCCCCc1nc(N)nc(N)n1)nc(N)n2 |
| InChI | 1S/C16H28N10/c17-13-21-11(22-14(18)25-13)9-7-5-3-1-2-4-6-8-10-12-23-15(19)26-16(20)24-12/h1-10H2,(H4,17,18,21,22,25)(H4,19,20,23,24,26) |
| InChIKey | NJMHCYOBRBPKCZ-UHFFFAOYSA-N |
| Density | 1.272g/cm3 (Cal.) |
|---|---|
| Boiling point | 733.738°C at 760 mmHg (Cal.) |
| Flash point | 438.053°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,6'-(1,10-Decanediyl)bis(1,3,5-triazine-2,4-diamine) |