Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1,1':1',1''-Ter(cyclopentane)-1,1'',3,3''-tetraene |
|---|---|
| Synonyms | [1,1':1',1''-tercyclopentane]-1,1'',3,3''-tetraene |
| Molecular Structure |  |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.30 |
| CAS Registry Number | 774577-93-4 |
| SMILES | C\1=C\C=C(/C/1)C2(CCCC2)C=3C\C=C/C=3 |
| InChI | 1S/C15H18/c1-2-8-13(7-1)15(11-5-6-12-15)14-9-3-4-10-14/h1-4,7,9H,5-6,8,10-12H2 |
| InChIKey | LNWRLPOEJXXRPC-UHFFFAOYSA-N |
| Density | 1.095g/cm3 (Cal.) |
|---|---|
| Boiling point | 300.962°C at 760 mmHg (Cal.) |
| Flash point | 116.661°C (Cal.) |
| Refractive index | 1.619 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1':1',1''-Ter(cyclopentane)-1,1'',3,3''-tetraene |