|
CAS#: 77479-09-5 Product: Sodium 4-Oxo-4-(4-Phenylphenyl)Butanoate No suppilers available for the product. |
| Name | Sodium 4-Oxo-4-(4-Phenylphenyl)Butanoate |
|---|---|
| Synonyms | Sodium 4-Keto-4-(4-Phenylphenyl)Butyrate; (1,1'-Biphenyl)-4-Butanoic Acid, Gamma-Oxo-, Sodium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C16H13NaO3 |
| Molecular Weight | 276.27 |
| CAS Registry Number | 77479-09-5 |
| SMILES | C2=C(C1=CC=CC=C1)C=CC(=C2)C(CCC([O-])=O)=O.[Na+] |
| InChI | 1S/C16H14O3.Na/c17-15(10-11-16(18)19)14-8-6-13(7-9-14)12-4-2-1-3-5-12;/h1-9H,10-11H2,(H,18,19);/q;+1/p-1 |
| InChIKey | XVQJIQGMWDJLSO-UHFFFAOYSA-M |
| Boiling point | 470.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 252.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 4-Oxo-4-(4-Phenylphenyl)Butanoate |