| Shanghai Zzbio Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.zzsrm.com | |||
![]() | +86 15102117276 | |||
![]() | 3001090745@qq.com info@zzsrm.com | |||
![]() | QQ Chat | |||
| Chemical distributor since 2013 | ||||
| chemBlink Standard supplier since 2021 | ||||
| Classification | Analytical chemistry >> Standard >> Forensic and veterinary standards |
|---|---|
| Name | Testosterone-16,16,17-D3 |
| Synonyms | (8R,9S,10R,13S,14S,17S)-16,16,17-trideuterio-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
| Molecular Structure | ![]() |
| Molecular Formula | C19H25D3O2 |
| Molecular Weight | 291.44 |
| CAS Registry Number | 77546-39-5 |
| EC Number | 867-598-0 |
| SMILES | [2H][C@]1([C@]2(CC[C@H]3[C@H]([C@@H]2CC1([2H])[2H])CCC4=CC(=O)CC[C@]34C)C)O |
| Density | 1.134 g/cm3 |
|---|---|
| Melting point | 148-150 °C |
| Boiling point | 432.925 °C, (760 mmHg) |
| Flash point | 5 °C |
| Hazard Symbols | |||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H302-H351-H360-H400 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for Testosterone-16,16,17-D3 |