Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | N-Acetyl-L-tyrosyl-L-phenylalanine |
|---|---|
| Synonyms | AC-TYR-PHE-OH |
| Molecular Structure |  |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.40 |
| CAS Registry Number | 7762-61-0 |
| SMILES | O=C(O)[C@@H](NC(=O)[C@@H](NC(=O)C)Cc1ccc(O)cc1)Cc2ccccc2 |
| InChI | 1S/C20H22N2O5/c1-13(23)21-17(11-15-7-9-16(24)10-8-15)19(25)22-18(20(26)27)12-14-5-3-2-4-6-14/h2-10,17-18,24H,11-12H2,1H3,(H,21,23)(H,22,25)(H,26,27)/t17-,18-/m0/s1 |
| InChIKey | LMNISZPMTXRXKN-ROUUACIJSA-N |
| Density | 1.288g/cm3 (Cal.) |
|---|---|
| Boiling point | 751.424°C at 760 mmHg (Cal.) |
| Flash point | 408.247°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Acetyl-L-tyrosyl-L-phenylalanine |