Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Amino-5-nitronicotinoyl chloride |
|---|---|
| Synonyms | 2-amino-5-nitronicotinoyl chloride; 3-PYRIDINECARBONYLCHLORIDE, 2-AMINO-5-NITRO- |
| Molecular Structure |  |
| Molecular Formula | C6H4ClN3O3 |
| Molecular Weight | 201.57 |
| CAS Registry Number | 776234-73-2 |
| SMILES | c1c(cnc(c1C(=O)Cl)N)[N+](=O)[O-] |
| InChI | 1S/C6H4ClN3O3/c7-5(11)4-1-3(10(12)13)2-9-6(4)8/h1-2H,(H2,8,9) |
| InChIKey | IPYLSODKPHBZCW-UHFFFAOYSA-N |
| Density | 1.636g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.58°C at 760 mmHg (Cal.) |
| Flash point | 201.507°C (Cal.) |
| Refractive index | 1.658 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-5-nitronicotinoyl chloride |