Online Database of Chemicals from Around the World
|
CAS#: 7763-98-6 Product: 2-Phenyl-3-Benzylaziridine No suppilers available for the product. |
| Name | 2-Phenyl-3-Benzylaziridine |
|---|---|
| Synonyms | 2-(Benzyl)-3-Phenyl-Ethylenimine; Nsc186290; Nsc149735 |
| Molecular Structure |  |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 |
| CAS Registry Number | 7763-98-6 (1605-08-9) |
| SMILES | C1=CC=C(C=C1)CC2C(N2)C3=CC=CC=C3 |
| InChI | 1S/C15H15N/c1-3-7-12(8-4-1)11-14-15(16-14)13-9-5-2-6-10-13/h1-10,14-16H,11H2 |
| InChIKey | HKLCRSPWWWHDBV-UHFFFAOYSA-N |
| Density | 1.091g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.506°C at 760 mmHg (Cal.) |
| Flash point | 163.223°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenyl-3-Benzylaziridine |