Online Database of Chemicals from Around the World
|
CAS#: 77630-47-8 Product: 3-Methoxy-2-methyl-3-oxopropyl benzoate No suppilers available for the product. |
| Name | 3-Methoxy-2-methyl-3-oxopropyl benzoate |
|---|---|
| Synonyms | 3-Methoxy-2-methyl-3-oxopropyl benzoate # |
| Molecular Structure |  |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 |
| CAS Registry Number | 77630-47-8 |
| SMILES | O=C(OCC(C(=O)OC)C)c1ccccc1 |
| InChI | 1S/C12H14O4/c1-9(11(13)15-2)8-16-12(14)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| InChIKey | WNADMYJZFVSGLU-UHFFFAOYSA-N |
| Density | 1.127g/cm3 (Cal.) |
|---|---|
| Boiling point | 317.816°C at 760 mmHg (Cal.) |
| Flash point | 154.991°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methoxy-2-methyl-3-oxopropyl benzoate |