Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-[(Dimethylamino)methyl]-2-ethylphenyl acetate |
|---|---|
| Synonyms | 3-((dimethylamino)methyl)-2-ethylphenyl acetate |
| Molecular Structure | ![CAS#: 777015-80-2， 3-[(Dimethylamino)methyl]-2-ethylphenyl acetate](/moreStructures/777015-80-2.gif) |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 |
| CAS Registry Number | 777015-80-2 |
| SMILES | CCc1c(cccc1OC(=O)C)CN(C)C |
| InChI | 1S/C13H19NO2/c1-5-12-11(9-14(3)4)7-6-8-13(12)16-10(2)15/h6-8H,5,9H2,1-4H3 |
| InChIKey | KCKLKYSVKSSGAB-UHFFFAOYSA-N |
| Density | 1.022g/cm3 (Cal.) |
|---|---|
| Boiling point | 269.7°C at 760 mmHg (Cal.) |
| Flash point | 87.674°C (Cal.) |
| Refractive index | 1.513 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[(Dimethylamino)methyl]-2-ethylphenyl acetate |