| Shanghai Yuanye Bio-Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 6155-9134/+86 400-665-5481 | |||
![]() |
shyysw030@163.com, | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2009 | ||||
| chemBlink standard supplier since 2016 | ||||
| Quality Phytochemicals LLC | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (908) 510-9277 | |||
![]() |
sales@qualityphytochemicalsllc.com | |||
| Chemical manufacturer | ||||
| Name | 1,6-Dimethyl-8,9-Dihydronaphtho[8,7-g][1]Benzoxole-10,11-Dione |
|---|---|
| Synonyms | 1,6-Dimethyl-8,9-Dihydronaphtho[8,7-G]Benzofuran-10,11-Dione; 1,6-Dimethyl-8,9-Dihydronaphtho[8,7-G]Benzofuran-10,11-Quinone; Phenanthro(1,2-B)Furan-10,11-Dione, 8,9-Dihydro-1,6-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H14O3 |
| Molecular Weight | 278.31 |
| CAS Registry Number | 77769-21-2 |
| SMILES | C4=C(C3=C(C1=C(C2=C(C=C1)C(=CCC2)C)C(C3=O)=O)O4)C |
| InChI | 1S/C18H14O3/c1-9-4-3-5-12-11(9)6-7-13-15(12)17(20)16(19)14-10(2)8-21-18(13)14/h4,6-8H,3,5H2,1-2H3 |
| InChIKey | OYOSADAKNZWZGA-UHFFFAOYSA-N |
| Density | 1.287g/cm3 (Cal.) |
|---|---|
| Boiling point | 495.614°C at 760 mmHg (Cal.) |
| Flash point | 244.565°C (Cal.) |
| (1) | J.-K. Qin, C.-Z. Liao, Y.-T. Wang, X.-Z. Bu, Z.-S. Huang and L.-Q. Gu. 8,9-Dihydro-1,6-dimethylphenanthro[1,2-b]furan-10,11-dione, Acta Cryst. (2005). E61, o804-o805 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,6-Dimethyl-8,9-Dihydronaphtho[8,7-g][1]Benzoxole-10,11-Dione |