Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Ethyl 6-hydroxy-1,2,3,4-tetrahydro-1-isoquinolinecarboxylate |
|---|---|
| Synonyms | ethyl-6-hydroxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylate |
| Molecular Structure |  |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.25 |
| CAS Registry Number | 780004-18-4 |
| SMILES | O=C(OCC)C2c1c(cc(O)cc1)CCN2 |
| InChI | 1S/C12H15NO3/c1-2-16-12(15)11-10-4-3-9(14)7-8(10)5-6-13-11/h3-4,7,11,13-14H,2,5-6H2,1H3 |
| InChIKey | UYKVSJYMKQPONE-UHFFFAOYSA-N |
| Density | 1.197g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.39°C at 760 mmHg (Cal.) |
| Flash point | 183.854°C (Cal.) |
| Refractive index | 1.554 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 6-hydroxy-1,2,3,4-tetrahydro-1-isoquinolinecarboxylate |