Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-(2,4-Dimethylphenyl)cyclohexanimine |
|---|---|
| Synonyms | BENZENAMINE,N-CYCLOHEXYLIDENE-2,4-DIMETHYL-; N-cyclohexylidene-2,4-dimethylaniline |
| Molecular Structure |  |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 |
| CAS Registry Number | 781628-61-3 |
| SMILES | N(/c1c(cc(cc1)C)C)=C2/CCCCC2 |
| InChI | 1S/C14H19N/c1-11-8-9-14(12(2)10-11)15-13-6-4-3-5-7-13/h8-10H,3-7H2,1-2H3 |
| InChIKey | CJTVUALTIFODSS-UHFFFAOYSA-N |
| Density | 0.987g/cm3 (Cal.) |
|---|---|
| Boiling point | 314.543°C at 760 mmHg (Cal.) |
| Flash point | 136.048°C (Cal.) |
| Refractive index | 1.546 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2,4-Dimethylphenyl)cyclohexanimine |