Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 5-Amino-4,6-dichloro-N-cyclopropyl-2-pyridinecarboxamide |
|---|---|
| Synonyms | 5-amino-4,6-dichloro-N-cyclopropylpicolinamide |
| Molecular Structure |  |
| Molecular Formula | C9H9Cl2N3O |
| Molecular Weight | 246.09 |
| CAS Registry Number | 784143-94-8 |
| SMILES | Clc1cc(nc(Cl)c1N)C(=O)NC2CC2 |
| InChI | 1S/C9H9Cl2N3O/c10-5-3-6(14-8(11)7(5)12)9(15)13-4-1-2-4/h3-4H,1-2,12H2,(H,13,15) |
| InChIKey | SYGPJICDWAGSEX-UHFFFAOYSA-N |
| Density | 1.529g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.986°C at 760 mmHg (Cal.) |
| Flash point | 184.819°C (Cal.) |
| Refractive index | 1.641 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Amino-4,6-dichloro-N-cyclopropyl-2-pyridinecarboxamide |