Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1R)-1-Mesitylethyl propionate |
|---|---|
| Synonyms | (R)-1-mesitylethyl propionate |
| Molecular Structure |  |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 |
| CAS Registry Number | 785784-20-5 |
| SMILES | CCC(=O)O[C@H](C)C1=C(C=C(C=C1C)C)C |
| InChI | 1S/C14H20O2/c1-6-13(15)16-12(5)14-10(3)7-9(2)8-11(14)4/h7-8,12H,6H2,1-5H3/t12-/m1/s1 |
| InChIKey | CCDYYIGTSGSXME-GFCCVEGCSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.6±9.0°C at 760 mmHg (Cal.) |
| Flash point | 106.6±17.1°C (Cal.) |
| Refractive index | 1.498 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R)-1-Mesitylethyl propionate |