|
CAS#: 786704-07-2 Product: Ethyl (2-bromo-1-methyl-1H-indol-3-yl)acetate No suppilers available for the product. |
| Name | Ethyl (2-bromo-1-methyl-1H-indol-3-yl)acetate |
|---|---|
| Synonyms | 2-Bromo-1-methyl-1H-indole-3-acetic acid ethyl ester |
| Molecular Formula | C13H14BrNO2 |
| Molecular Weight | 296.16 |
| CAS Registry Number | 786704-07-2 |
| SMILES | O=C(OCC)Cc2c1ccccc1n(c2Br)C |
| InChI | 1S/C13H14BrNO2/c1-3-17-12(16)8-10-9-6-4-5-7-11(9)15(2)13(10)14/h4-7H,3,8H2,1-2H3 |
| InChIKey | FABPMSWAXHGZDT-UHFFFAOYSA-N |
| Density | 1.408g/cm3 (Cal.) |
|---|---|
| Boiling point | 395.394°C at 760 mmHg (Cal.) |
| Flash point | 192.928°C (Cal.) |
| Refractive index | 1.587 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (2-bromo-1-methyl-1H-indol-3-yl)acetate |