Online Database of Chemicals from Around the World
| Name | Ethenyl 3,3-Dichloro-2,2,3-Trifluoropropanoate |
|---|---|
| Synonyms | Vinyl 3,3-Dichloro-2,2,3-Trifluoro-Propanoate; 3,3-Dichloro-2,2,3-Trifluoropropanoic Acid Vinyl Ester; 3,3-Dichloro-2,2,3-Trifluoro-Propionic Acid Vinyl Ester |
| Molecular Structure |  |
| Molecular Formula | C5H3Cl2F3O2 |
| Molecular Weight | 222.98 |
| CAS Registry Number | 78840-97-8 |
| EINECS | 278-993-7 |
| SMILES | O=C(OC=C)C(F)(F)C(Cl)(Cl)F |
| InChI | 1S/C5H3Cl2F3O2/c1-2-12-3(11)4(8,9)5(6,7)10/h2H,1H2 |
| InChIKey | VSKVRMXJKAFPSG-UHFFFAOYSA-N |
| Density | 1.498g/cm3 (Cal.) |
|---|---|
| Boiling point | 118.512°C at 760 mmHg (Cal.) |
| Flash point | 30.773°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethenyl 3,3-Dichloro-2,2,3-Trifluoropropanoate |
