Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-(2,4-Dichlorophenyl)-2-hydroxyethanimidamide |
|---|---|
| Synonyms | 2-(2,4-dichlorophenyl)-2-hydroxyacetimidamide |
| Molecular Structure |  |
| Molecular Formula | C8H8Cl2N2O |
| Molecular Weight | 219.07 |
| CAS Registry Number | 789425-82-7 |
| SMILES | c1cc(c(cc1Cl)Cl)C(C(=N)N)O |
| InChI | 1S/C8H8Cl2N2O/c9-4-1-2-5(6(10)3-4)7(13)8(11)12/h1-3,7,13H,(H3,11,12) |
| InChIKey | NXCBDAHPTVTDJW-UHFFFAOYSA-N |
| Density | 1.54g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.656°C at 760 mmHg (Cal.) |
| Flash point | 171.314°C (Cal.) |
| Refractive index | 1.632 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2,4-Dichlorophenyl)-2-hydroxyethanimidamide |