Online Database of Chemicals from Around the World
| Name | 7-Ethenoxy-1,1,2,2,3,3,4,4,5,5,6,6-Dodecafluoroheptane |
|---|---|
| Synonyms | 7-Ethenoxy-1,1,2,2,3,3,4,4,5,5,6,6-Dodecafluoro-Heptane; 2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoroheptoxyethylene; 1,1,2,2,3,3,4,4,5,5,6,6-Dodecafluoro-7-(Vinyloxy)Heptane |
| Molecular Structure |  |
| Molecular Formula | C9H6F12O |
| Molecular Weight | 358.13 |
| CAS Registry Number | 78971-81-0 |
| EINECS | 279-021-4 |
| SMILES | C(OC=C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | 1S/C9H6F12O/c1-2-22-3-5(12,13)7(16,17)9(20,21)8(18,19)6(14,15)4(10)11/h2,4H,1,3H2 |
| InChIKey | PSLCNUISXILWOY-UHFFFAOYSA-N |
| Density | 1.464g/cm3 (Cal.) |
|---|---|
| Boiling point | 169.512°C at 760 mmHg (Cal.) |
| Flash point | 62.502°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Ethenoxy-1,1,2,2,3,3,4,4,5,5,6,6-Dodecafluoroheptane |
