| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 1,3-Difluorotetrachloroacetone |
|---|---|
| Synonyms | 1,1,3,3-Tetrachloro-1,3-Difluoro-Propan-2-One; 1,1,3,3-Tetrachloro-1,3-Difluoro-Acetone; Zinc04329310 |
| Molecular Structure | ![]() |
| Molecular Formula | C3Cl4F2O |
| Molecular Weight | 231.84 |
| CAS Registry Number | 79-51-6 |
| SMILES | O=C(C(F)(Cl)Cl)C(F)(Cl)Cl |
| InChI | 1S/C3Cl4F2O/c4-2(5,8)1(10)3(6,7)9 |
| InChIKey | MXYOKVCIXGJEFW-UHFFFAOYSA-N |
| Density | 1.76g/cm3 (Cal.) |
|---|---|
| Boiling point | 144.269°C at 760 mmHg (Cal.) |
| 123-125°C (Expl.) | |
| Flash point | 41.053°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,3-Difluorotetrachloroacetone |