| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Biosynth AG. | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Name | (1R,4aS,4bR)-1,4a-Dimethyl-7-Propan-2-Yl-2,3,4,4b,5,9,10,10a-Octahydro Phenanthrene-1-Carboxylic Acid |
|---|---|
| Synonyms | (1R,4Ar,4Bs,10Ar)-7-Isopropyl-1,4A-Dimethyl-2,3,4,4B,5,9,10,10A-Octahydrophenanthrene-1-Carboxylic Acid; L-Sapietic Acid; .Delta.6,8(14)-Abietadienoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 |
| CAS Registry Number | 79-54-9 |
| SMILES | [C@]12([C@H]([C@@](C(=O)O)(C)CCC1)CCC3=CC(=CC[C@H]23)C(C)C)C |
| InChI | 1S/C20H30O2/c1-13(2)14-6-8-16-15(12-14)7-9-17-19(16,3)10-5-11-20(17,4)18(21)22/h6,12-13,16-17H,5,7-11H2,1-4H3,(H,21,22)/t16-,17+,19+,20+/m0/s1 |
| InChIKey | RWWVEQKPFPXLGL-ONCXSQPRSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 429.4±44.0°C at 760 mmHg (Cal.) |
| Flash point | 204.6±23.1°C (Cal.) |
| (1) | Motohiro Nishio. The CH/π hydrogen bond in chemistry. Conformation, supramolecules, optical resolution and interactions involving carbohydrates, Phys. Chem. Chem. Phys., 2011, 13, 13873. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (1R,4aS,4bR)-1,4a-Dimethyl-7-Propan-2-Yl-2,3,4,4b,5,9,10,10a-Octahydro Phenanthrene-1-Carboxylic Acid |