Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4,7-Dimethoxy-5,6-dimethyl-2-indanamine |
|---|---|
| Synonyms | 4,7-dimethoxy-5,6-dimethyl-2,3-dihydro-1H-inden-2-amine |
| Molecular Structure |  |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 |
| CAS Registry Number | 790175-64-3 |
| SMILES | COc2c1CC(N)Cc1c(OC)c(C)c2C |
| InChI | 1S/C13H19NO2/c1-7-8(2)13(16-4)11-6-9(14)5-10(11)12(7)15-3/h9H,5-6,14H2,1-4H3 |
| InChIKey | USZQZNNUVDQVRA-UHFFFAOYSA-N |
| Density | 1.071g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.054°C at 760 mmHg (Cal.) |
| Flash point | 198.076°C (Cal.) |
| Refractive index | 1.541 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,7-Dimethoxy-5,6-dimethyl-2-indanamine |