Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 7-amino-3-ethyl-1H-indole-5-carboxylate |
|---|---|
| Synonyms | methyl 7-amino-3-ethyl-1H-indole-5-carboxylate |
| Molecular Structure |  |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.25 |
| CAS Registry Number | 790254-22-7 |
| SMILES | CCc1c[nH]c2c1cc(cc2N)C(=O)OC |
| InChI | 1S/C12H14N2O2/c1-3-7-6-14-11-9(7)4-8(5-10(11)13)12(15)16-2/h4-6,14H,3,13H2,1-2H3 |
| InChIKey | OXERBZQPYKPVFA-UHFFFAOYSA-N |
| Density | 1.248g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.367°C at 760 mmHg (Cal.) |
| Flash point | 220.731°C (Cal.) |
| Refractive index | 1.654 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 7-amino-3-ethyl-1H-indole-5-carboxylate |