Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-Carbamoyl-D-homoserine |
|---|---|
| Synonyms | (R)-4-hydroxy-2-ureidobutanoic acid |
| Molecular Structure |  |
| Molecular Formula | C5H10N2O4 |
| Molecular Weight | 162.14 |
| CAS Registry Number | 79056-17-0 |
| SMILES | C(CO)[C@H](C(=O)O)NC(=O)N |
| InChI | 1S/C5H10N2O4/c6-5(11)7-3(1-2-8)4(9)10/h3,8H,1-2H2,(H,9,10)(H3,6,7,11)/t3-/m1/s1 |
| InChIKey | ZPKLHZSTXKNUST-GSVOUGTGSA-N |
| Density | 1.432g/cm3 (Cal.) |
|---|---|
| Boiling point | 435.104°C at 760 mmHg (Cal.) |
| Flash point | 216.943°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Carbamoyl-D-homoserine |