Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N7-Isobutyl-3-methyl-2H-indazole-5,7-diamine |
|---|---|
| Synonyms | N7-isobutyl-3-methyl-1H-indazole-5,7-diamine |
| Molecular Structure |  |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 |
| CAS Registry Number | 790657-70-4 |
| SMILES | n2c1c(cc(cc1c(n2)C)N)NCC(C)C |
| InChI | 1S/C12H18N4/c1-7(2)6-14-11-5-9(13)4-10-8(3)15-16-12(10)11/h4-5,7,14H,6,13H2,1-3H3,(H,15,16) |
| InChIKey | TZIOPTXXDXXBTN-UHFFFAOYSA-N |
| Density | 1.193g/cm3 (Cal.) |
|---|---|
| Boiling point | 314.51°C at 760 mmHg (Cal.) |
| Flash point | 144.011°C (Cal.) |
| Refractive index | 1.68 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N7-Isobutyl-3-methyl-2H-indazole-5,7-diamine |