Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-Methylphenyl 4-methylbenzenecarboximidate |
|---|---|
| Synonyms | p-tolyl 4-methylbenzimidate |
| Molecular Structure |  |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 |
| CAS Registry Number | 791022-84-9 |
| SMILES | Cc1ccc(cc1)C(=N)Oc2ccc(cc2)C |
| InChI | 1S/C15H15NO/c1-11-3-7-13(8-4-11)15(16)17-14-9-5-12(2)6-10-14/h3-10,16H,1-2H3 |
| InChIKey | GQRKCZQEUNXXTR-UHFFFAOYSA-N |
| Density | 1.031g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.061°C at 760 mmHg (Cal.) |
| Flash point | 147.368°C (Cal.) |
| Refractive index | 1.549 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methylphenyl 4-methylbenzenecarboximidate |