Online Database of Chemicals from Around the World
|
CAS#: 79133-02-1 Product: 3-Chloro-2,2-Bis(4-Chlorophenyl)Oxirane No suppilers available for the product. |
| Name | 3-Chloro-2,2-Bis(4-Chlorophenyl)Oxirane |
|---|---|
| Synonyms | Ethane, 1,1-Bis(P-Chlorophenyl)-2-Chloro-1,2-Epoxy-; Oxirane, 2,2-Bis(P-Chlorophenyl)-2-Chloro-; 1,1-Bis(P-Chlorophenyl)-2-Chloro-1,2-Epoxyethane |
| Molecular Structure |  |
| Molecular Formula | C14H9Cl3O |
| Molecular Weight | 299.58 |
| CAS Registry Number | 79133-02-1 |
| SMILES | C3=C(C2(C1=CC=C(C=C1)Cl)C(O2)Cl)C=CC(=C3)Cl |
| InChI | 1S/C14H9Cl3O/c15-11-5-1-9(2-6-11)14(13(17)18-14)10-3-7-12(16)8-4-10/h1-8,13H |
| InChIKey | YOLURZVIWIXYJT-UHFFFAOYSA-N |
| Density | 1.459g/cm3 (Cal.) |
|---|---|
| Boiling point | 395.067°C at 760 mmHg (Cal.) |
| Flash point | 148.321°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-2,2-Bis(4-Chlorophenyl)Oxirane |