Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 17beta-Hydroxy-1alpha-Methyl-17alpha-Propyl-5alpha-Androstan-3-One |
|---|---|
| Synonyms | 17-Propylmesterolone; 17Beta-Hydroxy-1Alpha-Methyl-17Alpha-Propyl-5Alpha-Androstan-3-One; Ccris 6531 |
| Molecular Structure |  |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.55 |
| CAS Registry Number | 79243-67-7 |
| EINECS | 279-119-7 |
| SMILES | [C@@H]23[C@H]([C@H]1[C@@]([C@@](O)(CC1)CCC)(CC2)C)CC[C@@H]4[C@@]3([C@H](CC(=O)C4)C)C |
| InChI | 1S/C23H38O2/c1-5-10-23(25)12-9-19-18-7-6-16-14-17(24)13-15(2)22(16,4)20(18)8-11-21(19,23)3/h15-16,18-20,25H,5-14H2,1-4H3/t15-,16-,18-,19-,20-,21-,22-,23-/m0/s1 |
| InChIKey | IMFNBOMNWHWKQD-MXENSADDSA-N |
| Density | 1.019g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.542°C at 760 mmHg (Cal.) |
| Flash point | 191.929°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 17beta-Hydroxy-1alpha-Methyl-17alpha-Propyl-5alpha-Androstan-3-One |