Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Acetyl-N,N-Dimethylleucinamide |
|---|---|
| Synonyms | 2-Acetamido-N,N,4-Trimethyl-Pentanamide; 2-Acetamido-N,N,4-Trimethyl-Valeramide; Ac-Leu-Nme2 |
| Molecular Structure |  |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 |
| CAS Registry Number | 79254-51-6 |
| SMILES | C(C(C(=O)N(C)C)NC(=O)C)C(C)C |
| InChI | 1S/C10H20N2O2/c1-7(2)6-9(11-8(3)13)10(14)12(4)5/h7,9H,6H2,1-5H3,(H,11,13) |
| InChIKey | BKNLDDNCAZDJQM-UHFFFAOYSA-N |
| Density | 0.979g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.039°C at 760 mmHg (Cal.) |
| Flash point | 170.941°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Acetyl-N,N-Dimethylleucinamide |