Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Trimethylsilyl alaninate |
|---|---|
| Synonyms | (R)-trimethylsilyl 2-aminopropanoate |
| Molecular Structure |  |
| Molecular Formula | C6H15NO2Si |
| Molecular Weight | 161.27 |
| CAS Registry Number | 79338-42-4 |
| SMILES | N[C@H](C)C(=O)O[Si](C)(C)C |
| InChI | 1S/C6H15NO2Si/c1-5(7)6(8)9-10(2,3)4/h5H,7H2,1-4H3/t5-/m1/s1 |
| InChIKey | OTZAXEIMULLWKT-RXMQYKEDSA-N |
| Density | 0.944g/cm3 (Cal.) |
|---|---|
| Boiling point | 151.883°C at 760 mmHg (Cal.) |
| Flash point | 45.658°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethylsilyl alaninate |